About 3-methyl-5-nitro-1H-1,2,4-triazole
3-methyl-5-nitro-1H-1,2,4-triazole (PubChem CID 135412912) has the molecular formula C3H4N4O2
and a molecular weight of 128.09 g/mol. Its IUPAC name is 3-methyl-5-nitro-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-methyl-5-nitro-1H-1,2,4-triazole |
| PubChem CID | 135412912 |
| Molecular Formula | C3H4N4O2 |
| Molecular Weight | 128.09 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 3-methyl-5-nitro-1H-1,2,4-triazole |
| SMILES | Cc1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H4N4O2/c1-2-4-3(6-5-2)7(8)9/h1H3,(H,4,5,6) |
| InChIKey | AUKCNKCAXZBVAM-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.09 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-nitro-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-nitro-1H-1,2,4-triazole?
The IUPAC name of 3-methyl-5-nitro-1H-1,2,4-triazole (CID 135412912) is 3-methyl-5-nitro-1H-1,2,4-triazole.
What is the SMILES notation for 3-methyl-5-nitro-1H-1,2,4-triazole?
The canonical SMILES for 3-methyl-5-nitro-1H-1,2,4-triazole is Cc1n[nH]c([N+](=O)[O-])n1.
What is the InChIKey of 3-methyl-5-nitro-1H-1,2,4-triazole?
The InChIKey is AUKCNKCAXZBVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O2/c1-2-4-3(6-5-2)7(8)9/h1H3,(H,4,5,6).
What are the key properties of 3-methyl-5-nitro-1H-1,2,4-triazole?
3-methyl-5-nitro-1H-1,2,4-triazole has a molecular weight of 128.09 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-nitro-1H-1,2,4-triazole is sourced from PubChem (CID 135412912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).