C14H21N3O2S — CID 135412918
N-ethyl-1,1-dioxo-7-pentyl-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135412918) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-ethyl-1,1-dioxo-7-pentyl-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | N-ethyl-1,1-dioxo-7-pentyl-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135412918 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-ethyl-1,1-dioxo-7-pentyl-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCCCCc1ccc2c(c1)S(=O)(=O)N/C(=N/CC)N2 |
| InChI | InChI=1S/C14H21N3O2S/c1-3-5-6-7-11-8-9-12-13(10-11)20(18,19)17-14(16-12)15-4-2/h8-10H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | HFICTFOOOQAAFR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|