C11H12F3N3O2S — CID 135412919
1,1-dioxo-N-propyl-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 135412919) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 1,1-dioxo-N-propyl-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 1,1-dioxo-N-propyl-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 135412919 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1,1-dioxo-N-propyl-7-(trifluoromethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CCC/N=C1\Nc2ccc(C(F)(F)F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C11H12F3N3O2S/c1-2-5-15-10-16-8-4-3-7(11(12,13)14)6-9(8)20(18,19)17-10/h3-4,6H,2,5H2,1H3,(H2,15,16,17) |
| InChIKey | XKWMCTLTNJLLGO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|