C25H25N5O — CID 135413013
4-[4-(7-ethyl-2-pyridin-4-yl-3H-1,3,4-benzotriazepin-5-yl)phenyl]morpholine (PubChem CID 135413013) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[4-(7-ethyl-2-pyridin-4-yl-3H-1,3,4-benzotriazepin-5-yl)phenyl]morpholine.
| Compound Name | 4-[4-(7-ethyl-2-pyridin-4-yl-3H-1,3,4-benzotriazepin-5-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 135413013 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-[4-(7-ethyl-2-pyridin-4-yl-3H-1,3,4-benzotriazepin-5-yl)phenyl]morpholine |
| SMILES | CCc1ccc2c(c1)C(c1ccc(N3CCOCC3)cc1)=NNC(c1ccncc1)=N2 |
| InChI | InChI=1S/C25H25N5O/c1-2-18-3-8-23-22(17-18)24(28-29-25(27-23)20-9-11-26-12-10-20)19-4-6-21(7-5-19)30-13-15-31-16-14-30/h3-12,17H,2,13-16H2,1H3,(H,27,29) |
| InChIKey | CTOKHJVMZICUCU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |