C22H31N3O3S — CID 135413049
2-benzyl-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135413049) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-benzyl-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-benzyl-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135413049 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-benzyl-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCS(=O)(=O)N1CCc2nc(Cc3ccccc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H31N3O3S/c1-2-3-4-5-6-10-15-29(27,28)25-14-13-20-19(17-25)22(26)24-21(23-20)16-18-11-8-7-9-12-18/h7-9,11-12H,2-6,10,13-17H2,1H3,(H,23,24,26) |
| InChIKey | CMVVUPFZBWLXRO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|