C8H8N4O — CID 135413405
2,6-diamino-3H-quinazolin-4-one (PubChem CID 135413405) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 2,6-diamino-3H-quinazolin-4-one.
| Compound Name | 2,6-diamino-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135413405 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2,6-diamino-3H-quinazolin-4-one |
| SMILES | Nc1ccc2nc(N)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C8H8N4O/c9-4-1-2-6-5(3-4)7(13)12-8(10)11-6/h1-3H,9H2,(H3,10,11,12,13) |
| InChIKey | YCRCNZBZUQLULA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|