C16H15N5O3 — CID 135413699
10-(4-ethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione (PubChem CID 135413699) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 10-(4-ethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione.
| Compound Name | 10-(4-ethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
|---|---|
| PubChem CID | 135413699 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 10-(4-ethoxyphenyl)-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
| SMILES | CCOc1ccc(C2CC(=O)Nc3c2c(=O)[nH]c2ncnn32)cc1 |
| InChI | InChI=1S/C16H15N5O3/c1-2-24-10-5-3-9(4-6-10)11-7-12(22)19-14-13(11)15(23)20-16-17-8-18-21(14)16/h3-6,8,11H,2,7H2,1H3,(H,19,22)(H,17,18,20,23) |
| InChIKey | FBDPULFZOFHGEP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |