C19H24N4O4S2 — CID 135414013
2-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one (PubChem CID 135414013) has the molecular formula C19H24N4O4S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135414013 |
| Molecular Formula | C19H24N4O4S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C19H24N4O4S2/c1-2-6-15-13-17(24)21-19(20-15)28-14-18(25)22-9-11-23(12-10-22)29(26,27)16-7-4-3-5-8-16/h3-5,7-8,13H,2,6,9-12,14H2,1H3,(H,20,21,24) |
| InChIKey | KAGBKAFZSYQNDV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |