About 7,9-dihydro-1H-purine-6,8-dione
7,9-dihydro-1H-purine-6,8-dione (PubChem CID 135414099) has the molecular formula C5H4N4O2
and a molecular weight of 152.11 g/mol. Its IUPAC name is 7,9-dihydro-1H-purine-6,8-dione.
Molecular Properties
| Compound Name | 7,9-dihydro-1H-purine-6,8-dione |
| PubChem CID | 135414099 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 7,9-dihydro-1H-purine-6,8-dione |
| SMILES | O=c1[nH]c2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-3(6-1-7-4)9-5(11)8-2/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | BYUOBSUZYQAFJM-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,9-dihydro-1H-purine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dihydro-1H-purine-6,8-dione?
The IUPAC name of 7,9-dihydro-1H-purine-6,8-dione (CID 135414099) is 7,9-dihydro-1H-purine-6,8-dione.
What is the SMILES notation for 7,9-dihydro-1H-purine-6,8-dione?
The canonical SMILES for 7,9-dihydro-1H-purine-6,8-dione is O=c1[nH]c2nc[nH]c(=O)c2[nH]1.
What is the InChIKey of 7,9-dihydro-1H-purine-6,8-dione?
The InChIKey is BYUOBSUZYQAFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2/c10-4-2-3(6-1-7-4)9-5(11)8-2/h1H,(H3,6,7,8,9,10,11).
What are the key properties of 7,9-dihydro-1H-purine-6,8-dione?
7,9-dihydro-1H-purine-6,8-dione has a molecular weight of 152.11 g/mol, XLogP of -1.06, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dihydro-1H-purine-6,8-dione is sourced from PubChem (CID 135414099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).