C17H13FN4OS — CID 135414404
7-fluoro-5-(furan-2-yl)-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine (PubChem CID 135414404) has the molecular formula C17H13FN4OS and a molecular weight of 340.38 g/mol. Its IUPAC name is 7-fluoro-5-(furan-2-yl)-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine.
| Compound Name | 7-fluoro-5-(furan-2-yl)-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135414404 |
| Molecular Formula | C17H13FN4OS |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 7-fluoro-5-(furan-2-yl)-N-methyl-3-thiophen-2-yl-1,3-dihydropyrido[2,3-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\Nc2ncc(F)cc2C(c2ccco2)=NC1c1cccs1 |
| InChI | InChI=1S/C17H13FN4OS/c1-19-17-15(13-5-3-7-24-13)21-14(12-4-2-6-23-12)11-8-10(18)9-20-16(11)22-17/h2-9,15H,1H3,(H,19,20,22) |
| InChIKey | AGGVEVBWXVFIHF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|