C23H22N4O2S — CID 135414457
3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-[1-(1-methylcyclopropyl)indol-4-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 135414457) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-[1-(1-methylcyclopropyl)indol-4-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-[1-(1-methylcyclopropyl)indol-4-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135414457 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-(5-cyclopropyl-2,4-dihydroxyphenyl)-4-[1-(1-methylcyclopropyl)indol-4-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC1(n2ccc3c(-n4c(-c5cc(C6CC6)c(O)cc5O)n[nH]c4=S)cccc32)CC1 |
| InChI | InChI=1S/C23H22N4O2S/c1-23(8-9-23)26-10-7-14-17(26)3-2-4-18(14)27-21(24-25-22(27)30)16-11-15(13-5-6-13)19(28)12-20(16)29/h2-4,7,10-13,28-29H,5-6,8-9H2,1H3,(H,25,30) |
| InChIKey | VDODPAGJCVTEJQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|