C32H41FN6O2 — CID 135414526
1-(3,3-dimethylbutyl)-N-[[4-(1,8-dimethyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)-3-fluorophenyl]methyl]piperidine-4-carboxamide (PubChem CID 135414526) has the molecular formula C32H41FN6O2 and a molecular weight of 560.72 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-N-[[4-(1,8-dimethyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)-3-fluorophenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,3-dimethylbutyl)-N-[[4-(1,8-dimethyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)-3-fluorophenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135414526 |
| Molecular Formula | C32H41FN6O2 |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-N-[[4-(1,8-dimethyl-4,10-dihydropyrazolo[4,5-c][1,5]benzodiazepine-5-carbonyl)-3-fluorophenyl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc2c(c1)Nc1c(cnn1C)CN2C(=O)c1ccc(CNC(=O)C2CCN(CCC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C32H41FN6O2/c1-21-6-9-28-27(16-21)36-29-24(19-35-37(29)5)20-39(28)31(41)25-8-7-22(17-26(25)33)18-34-30(40)23-10-13-38(14-11-23)15-12-32(2,3)4/h6-9,16-17,19,23,36H,10-15,18,20H2,1-5H3,(H,34,40) |
| InChIKey | OTBOBJBGFFPUER-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |