C21H24N4O4S — CID 135414861
4-[2-[1-[2-(4-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]ethyl]benzenesulfonamide (PubChem CID 135414861) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-[2-[1-[2-(4-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[1-[2-(4-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135414861 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[2-[1-[2-(4-methoxyphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(-n2[nH]c(C)c(/C(C)=N/CCc3ccc(S(N)(=O)=O)cc3)c2=O)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-14(23-13-12-16-4-10-19(11-5-16)30(22,27)28)20-15(2)24-25(21(20)26)17-6-8-18(29-3)9-7-17/h4-11,24H,12-13H2,1-3H3,(H2,22,27,28)/b23-14+ |
| InChIKey | DYHWENGVJQMTTL-OEAKJJBVSA-N |
| XLogP | 2.18 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|