About (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135415455) has the molecular formula C20H16N4O4
and a molecular weight of 376.37 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
Molecular Properties
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| PubChem CID | 135415455 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)OCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H16N4O4/c25-18(11-10-16-21-15-9-5-4-8-14(15)19(26)22-16)27-12-17-23-24-20(28-17)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,21,22,26) |
| InChIKey | ZSEXLHYPCLHPLO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate?
The IUPAC name of (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate (CID 135415455) is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
What is the SMILES notation for (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate?
The canonical SMILES for (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate is O=C(CCc1nc2ccccc2c(=O)[nH]1)OCc1nnc(-c2ccccc2)o1.
What is the InChIKey of (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate?
The InChIKey is ZSEXLHYPCLHPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O4/c25-18(11-10-16-21-15-9-5-4-8-14(15)19(26)22-16)27-12-17-23-24-20(28-17)13-6-2-1-3-7-13/h1-9H,10-12H2,(H,21,22,26).
What are the key properties of (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate?
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate has a molecular weight of 376.37 g/mol, XLogP of 2.65, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-(4-oxo-3H-quinazolin-2-yl)propanoate is sourced from PubChem (CID 135415455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).