C9H13N3O — CID 135415460
(NE)-N-(3-ethyl-1,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine (PubChem CID 135415460) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is (NE)-N-(3-ethyl-1,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(3-ethyl-1,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135415460 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (NE)-N-(3-ethyl-1,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine |
| SMILES | CCc1n[nH]c2c1/C(=N/O)CCC2 |
| InChI | InChI=1S/C9H13N3O/c1-2-6-9-7(11-10-6)4-3-5-8(9)12-13/h13H,2-5H2,1H3,(H,10,11)/b12-8+ |
| InChIKey | AHBUGPSNJPVRFM-XYOKQWHBSA-N |
| XLogP | 1.49 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|