About 3H-[1]benzofuro[3,2-d]pyrimidin-4-one
3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 135415469) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| PubChem CID | 135415469 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1oc1ccccc12 |
| InChI | InChI=1S/C10H6N2O2/c13-10-9-8(11-5-12-10)6-3-1-2-4-7(6)14-9/h1-5H,(H,11,12,13) |
| InChIKey | PCCWPSFTRGJXEF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-[1]benzofuro[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-[1]benzofuro[3,2-d]pyrimidin-4-one?
The IUPAC name of 3H-[1]benzofuro[3,2-d]pyrimidin-4-one (CID 135415469) is 3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3H-[1]benzofuro[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3H-[1]benzofuro[3,2-d]pyrimidin-4-one is O=c1[nH]cnc2c1oc1ccccc12.
What is the InChIKey of 3H-[1]benzofuro[3,2-d]pyrimidin-4-one?
The InChIKey is PCCWPSFTRGJXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c13-10-9-8(11-5-12-10)6-3-1-2-4-7(6)14-9/h1-5H,(H,11,12,13).
What are the key properties of 3H-[1]benzofuro[3,2-d]pyrimidin-4-one?
3H-[1]benzofuro[3,2-d]pyrimidin-4-one has a molecular weight of 186.17 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-[1]benzofuro[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 135415469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).