C36H22N4S4 — CID 135415698
5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin (PubChem CID 135415698) has the molecular formula C36H22N4S4 and a molecular weight of 638.87 g/mol. Its IUPAC name is 5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135415698 |
| Molecular Formula | C36H22N4S4 |
| Molecular Weight | 638.87 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | 5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(-c1cccs1)c1ccc([nH]1)c(-c1cccs1)c1nc(c(-c3cccs3)c3ccc([nH]3)c2-c2cccs2)C=C1 |
| InChI | InChI=1S/C36H22N4S4/c1-5-29(41-17-1)33-21-9-11-23(37-21)34(30-6-2-18-42-30)25-13-15-27(39-25)36(32-8-4-20-44-32)28-16-14-26(40-28)35(31-7-3-19-43-31)24-12-10-22(33)38-24/h1-20,37,40H/b33-21+,33-22+,34-23+,34-25+,35-24+,35-26+,36-27+,36-28+ |
| InChIKey | QTBZIEZZDWDDFD-DVBRDLRJSA-N |
| XLogP | 11.57 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.87 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |