C29H35FN4O — CID 135416370
(5R,7S)-8-benzyl-1-(3-fluorophenyl)-7-methyl-4-spiro[2.5]octan-6-ylimino-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 135416370) has the molecular formula C29H35FN4O and a molecular weight of 474.62 g/mol. Its IUPAC name is (5R,7S)-8-benzyl-1-(3-fluorophenyl)-7-methyl-4-spiro[2.5]octan-6-ylimino-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | (5R,7S)-8-benzyl-1-(3-fluorophenyl)-7-methyl-4-spiro[2.5]octan-6-ylimino-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 135416370 |
| Molecular Formula | C29H35FN4O |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (5R,7S)-8-benzyl-1-(3-fluorophenyl)-7-methyl-4-spiro[2.5]octan-6-ylimino-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | C[C@H]1C[C@]2(CCN1Cc1ccccc1)/C(=N/C1CCC3(CC1)CC3)NC(=O)N2c1cccc(F)c1 |
| InChI | InChI=1S/C29H35FN4O/c1-21-19-29(16-17-33(21)20-22-6-3-2-4-7-22)26(31-24-10-12-28(13-11-24)14-15-28)32-27(35)34(29)25-9-5-8-23(30)18-25/h2-9,18,21,24H,10-17,19-20H2,1H3,(H,31,32,35)/t21-,29+/m0/s1 |
| InChIKey | SYUMOUYUBFZQML-KCWXNJEJSA-N |
| XLogP | 5.90 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|