C25H26F3N5O — CID 135416453
N-(2,4-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135416453) has the molecular formula C25H26F3N5O and a molecular weight of 469.51 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135416453 |
| Molecular Formula | C25H26F3N5O |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-methyl-7-(4-propan-2-ylphenyl)-2-(trifluoromethyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(C(C)C)cc2)n2nc(C(F)(F)F)nc2N1 |
| InChI | InChI=1S/C25H26F3N5O/c1-13(2)17-7-9-18(10-8-17)21-20(22(34)30-19-11-6-14(3)12-15(19)4)16(5)29-24-31-23(25(26,27)28)32-33(21)24/h6-13,21H,1-5H3,(H,30,34)(H,29,31,32) |
| InChIKey | SOYXQCNMAQSCAB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |