C25H21NO5S — CID 135416719
methyl 5-[(2,4-dimethoxyphenyl)methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate (PubChem CID 135416719) has the molecular formula C25H21NO5S and a molecular weight of 447.51 g/mol. Its IUPAC name is methyl 5-[(2,4-dimethoxyphenyl)methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate.
| Compound Name | methyl 5-[(2,4-dimethoxyphenyl)methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135416719 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | methyl 5-[(2,4-dimethoxyphenyl)methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccc(OC)cc2OC)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C25H21NO5S/c1-29-17-12-11-16(20(14-17)30-2)13-21-23(27)22(25(28)31-3)24(32-21)26-19-10-6-8-15-7-4-5-9-18(15)19/h4-14,27H,1-3H3/b21-13?,26-24- |
| InChIKey | PGKRPBGOWIUHEW-JOSZCPNPSA-N |
| XLogP | 5.66 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|