C6H8N10O4 — CID 135416907
N-[3-[2-(5-nitramido-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazol-5-yl]nitramide (PubChem CID 135416907) has the molecular formula C6H8N10O4 and a molecular weight of 284.20 g/mol. Its IUPAC name is N-[3-[2-(5-nitramido-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazol-5-yl]nitramide.
| Compound Name | N-[3-[2-(5-nitramido-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazol-5-yl]nitramide |
|---|---|
| PubChem CID | 135416907 |
| Molecular Formula | C6H8N10O4 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-[3-[2-(5-nitramido-1H-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazol-5-yl]nitramide |
| SMILES | O=[N+]([O-])Nc1nc(CCc2n[nH]c(N[N+](=O)[O-])n2)n[nH]1 |
| InChI | InChI=1S/C6H8N10O4/c17-15(18)13-5-7-3(9-11-5)1-2-4-8-6(12-10-4)14-16(19)20/h1-2H2,(H2,7,9,11,13)(H2,8,10,12,14) |
| InChIKey | SDKDMZIVZNSLSH-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 193.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|