About 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate (PubChem CID 135417057) has the molecular formula C15H13N3O4S
and a molecular weight of 331.35 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate |
| PubChem CID | 135417057 |
| Molecular Formula | C15H13N3O4S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C15H13N3O4S/c19-15(11-4-3-7-16-10-11)22-9-8-17-14-12-5-1-2-6-13(12)23(20,21)18-14/h1-7,10H,8-9H2,(H,17,18) |
| InChIKey | KLPWQSDNGJYNTH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate?
The IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate (CID 135417057) is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate.
What is the SMILES notation for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate?
The canonical SMILES for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate is O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1cccnc1.
What is the InChIKey of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate?
The InChIKey is KLPWQSDNGJYNTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O4S/c19-15(11-4-3-7-16-10-11)22-9-8-17-14-12-5-1-2-6-13(12)23(20,21)18-14/h1-7,10H,8-9H2,(H,17,18).
What are the key properties of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate?
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate has a molecular weight of 331.35 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl pyridine-3-carboxylate is sourced from PubChem (CID 135417057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).