C17H23N3O4S — CID 135417060
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-(azepan-1-yl)acetate (PubChem CID 135417060) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-(azepan-1-yl)acetate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-(azepan-1-yl)acetate |
|---|---|
| PubChem CID | 135417060 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-(azepan-1-yl)acetate |
| SMILES | O=C(CN1CCCCCC1)OCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O4S/c21-16(13-20-10-5-1-2-6-11-20)24-12-9-18-17-14-7-3-4-8-15(14)25(22,23)19-17/h3-4,7-8H,1-2,5-6,9-13H2,(H,18,19) |
| InChIKey | QMZRTZAADUKIPI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|