C17H19ClN2 — CID 135417138
N-methyl-3-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride (PubChem CID 135417138) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is N-methyl-3-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride.
| Compound Name | N-methyl-3-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 135417138 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-methyl-3-phenyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
| SMILES | C/N=C1\Nc2ccccc2CCC1c1ccccc1.Cl |
| InChI | InChI=1S/C17H18N2.ClH/c1-18-17-15(13-7-3-2-4-8-13)12-11-14-9-5-6-10-16(14)19-17;/h2-10,15H,11-12H2,1H3,(H,18,19);1H |
| InChIKey | LDVTZRCBLGURKU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|