C19H23ClN2 — CID 135417140
3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride (PubChem CID 135417140) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride.
| Compound Name | 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 135417140 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
| SMILES | CCC/N=C1\Nc2ccccc2CCC1c1ccccc1.Cl |
| InChI | InChI=1S/C19H22N2.ClH/c1-2-14-20-19-17(15-8-4-3-5-9-15)13-12-16-10-6-7-11-18(16)21-19;/h3-11,17H,2,12-14H2,1H3,(H,20,21);1H |
| InChIKey | KJKKEDDCWPTDNT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|