C19H22N2 — CID 135417141
3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine (PubChem CID 135417141) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine.
| Compound Name | 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine |
|---|---|
| PubChem CID | 135417141 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-phenyl-N-propyl-1,3,4,5-tetrahydro-1-benzazepin-2-imine |
| SMILES | CCC/N=C1\Nc2ccccc2CCC1c1ccccc1 |
| InChI | InChI=1S/C19H22N2/c1-2-14-20-19-17(15-8-4-3-5-9-15)13-12-16-10-6-7-11-18(16)21-19/h3-11,17H,2,12-14H2,1H3,(H,20,21) |
| InChIKey | UWNPWZAPUCIRMH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|