C20H24Cl2N2O — CID 135417146
3-(4-chlorophenyl)-N-(3-methoxypropyl)-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride (PubChem CID 135417146) has the molecular formula C20H24Cl2N2O and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(3-methoxypropyl)-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride.
| Compound Name | 3-(4-chlorophenyl)-N-(3-methoxypropyl)-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 135417146 |
| Molecular Formula | C20H24Cl2N2O |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(3-methoxypropyl)-1,3,4,5-tetrahydro-1-benzazepin-2-imine;hydrochloride |
| SMILES | COCCC/N=C1\Nc2ccccc2CCC1c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C20H23ClN2O.ClH/c1-24-14-4-13-22-20-18(15-7-10-17(21)11-8-15)12-9-16-5-2-3-6-19(16)23-20;/h2-3,5-8,10-11,18H,4,9,12-14H2,1H3,(H,22,23);1H |
| InChIKey | IGNIXULZPFBZRE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|