About 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole
3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole (PubChem CID 135417206) has the molecular formula C14H10N4O
and a molecular weight of 250.26 g/mol. Its IUPAC name is 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole |
| PubChem CID | 135417206 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2nc3c(cnc4ccccc43)[nH]2)no1 |
| InChI | InChI=1S/C14H10N4O/c1-8-6-11(18-19-8)14-16-12-7-15-10-5-3-2-4-9(10)13(12)17-14/h2-7H,1H3,(H,16,17) |
| InChIKey | YMIRZFZYJWHEIT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole?
The IUPAC name of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole (CID 135417206) is 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole.
What is the SMILES notation for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole?
The canonical SMILES for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole is Cc1cc(-c2nc3c(cnc4ccccc43)[nH]2)no1.
What is the InChIKey of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole?
The InChIKey is YMIRZFZYJWHEIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O/c1-8-6-11(18-19-8)14-16-12-7-15-10-5-3-2-4-9(10)13(12)17-14/h2-7H,1H3,(H,16,17).
What are the key properties of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole?
3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole has a molecular weight of 250.26 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-5-methyl-1,2-oxazole is sourced from PubChem (CID 135417206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).