About 4-(4,5-dihydro-1H-imidazol-2-yl)phenol
4-(4,5-dihydro-1H-imidazol-2-yl)phenol (PubChem CID 135417369) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-yl)phenol |
| PubChem CID | 135417369 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-yl)phenol |
| SMILES | Oc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C9H10N2O/c12-8-3-1-7(2-4-8)9-10-5-6-11-9/h1-4,12H,5-6H2,(H,10,11) |
| InChIKey | NPDVQVNFWYFKNU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,5-dihydro-1H-imidazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)phenol?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-yl)phenol (CID 135417369) is 4-(4,5-dihydro-1H-imidazol-2-yl)phenol.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-yl)phenol?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-yl)phenol is Oc1ccc(C2=NCCN2)cc1.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-yl)phenol?
The InChIKey is NPDVQVNFWYFKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c12-8-3-1-7(2-4-8)9-10-5-6-11-9/h1-4,12H,5-6H2,(H,10,11).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-yl)phenol?
4-(4,5-dihydro-1H-imidazol-2-yl)phenol has a molecular weight of 162.19 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-yl)phenol is sourced from PubChem (CID 135417369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).