About 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride
3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride (PubChem CID 135417389) has the molecular formula C24H28ClN3O2
and a molecular weight of 425.96 g/mol. Its IUPAC name is 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride.
Molecular Properties
| Compound Name | 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride |
| PubChem CID | 135417389 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride |
| SMILES | CC(CCN1CCN(c2ccccc2)CC1)/N=C/C1=C(O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C24H27N3O2.ClH/c1-18(25-17-22-23(28)20-9-5-6-10-21(20)24(22)29)11-12-26-13-15-27(16-14-26)19-7-3-2-4-8-19;/h2-10,17-18,28H,11-16H2,1H3;1H/b25-17+; |
| InChIKey | XNDLMYBXXGVXNW-AREUYOMRSA-N |
| XLogP | 4.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride?
The IUPAC name of 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride (CID 135417389) is 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride.
What is the SMILES notation for 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride?
The canonical SMILES for 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride is CC(CCN1CCN(c2ccccc2)CC1)/N=C/C1=C(O)c2ccccc2C1=O.Cl.
What is the InChIKey of 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride?
The InChIKey is XNDLMYBXXGVXNW-AREUYOMRSA-N. The full InChI is InChI=1S/C24H27N3O2.ClH/c1-18(25-17-22-23(28)20-9-5-6-10-21(20)24(22)29)11-12-26-13-15-27(16-14-26)19-7-3-2-4-8-19;/h2-10,17-18,28H,11-16H2,1H3;1H/b25-17+;.
What are the key properties of 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride?
3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride has a molecular weight of 425.96 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[4-(4-phenylpiperazin-1-yl)butan-2-yliminomethyl]inden-1-one;hydrochloride is sourced from PubChem (CID 135417389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).