C24H23N7O4 — CID 135417772
3-[(4-methylphenyl)methyl]-5-[1-(3-nitrobenzoyl)piperidin-4-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135417772) has the molecular formula C24H23N7O4 and a molecular weight of 473.49 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-5-[1-(3-nitrobenzoyl)piperidin-4-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-[(4-methylphenyl)methyl]-5-[1-(3-nitrobenzoyl)piperidin-4-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135417772 |
| Molecular Formula | C24H23N7O4 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-5-[1-(3-nitrobenzoyl)piperidin-4-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1ccc(Cn2nnc3c(=O)[nH]c(C4CCN(C(=O)c5cccc([N+](=O)[O-])c5)CC4)nc32)cc1 |
| InChI | InChI=1S/C24H23N7O4/c1-15-5-7-16(8-6-15)14-30-22-20(27-28-30)23(32)26-21(25-22)17-9-11-29(12-10-17)24(33)18-3-2-4-19(13-18)31(34)35/h2-8,13,17H,9-12,14H2,1H3,(H,25,26,32) |
| InChIKey | YEEQGEGYNXQACD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|