About 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one
3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135417939) has the molecular formula C25H28N4O
and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135417939 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)c2[nH]c(=O)c(CNCCc3ccccc3)cc12 |
| InChI | InChI=1S/C25H28N4O/c1-25(2,3)22-21-16-19(17-26-15-14-18-10-6-4-7-11-18)24(30)27-23(21)29(28-22)20-12-8-5-9-13-20/h4-13,16,26H,14-15,17H2,1-3H3,(H,27,30) |
| InChIKey | PPHWPANSTLDQHE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135417939) is 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one is CC(C)(C)c1nn(-c2ccccc2)c2[nH]c(=O)c(CNCCc3ccccc3)cc12.
What is the InChIKey of 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is PPHWPANSTLDQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4O/c1-25(2,3)22-21-16-19(17-26-15-14-18-10-6-4-7-11-18)24(30)27-23(21)29(28-22)20-12-8-5-9-13-20/h4-13,16,26H,14-15,17H2,1-3H3,(H,27,30).
What are the key properties of 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one?
3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 400.53 g/mol, XLogP of 4.34, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-phenyl-5-[(2-phenylethylamino)methyl]-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135417939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).