C18H13N5O2 — CID 135418267
4-amino-3,6-diphenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione (PubChem CID 135418267) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-amino-3,6-diphenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione.
| Compound Name | 4-amino-3,6-diphenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione |
|---|---|
| PubChem CID | 135418267 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-amino-3,6-diphenyl-7H-pyrimido[5,4-d]pyrimidine-2,8-dione |
| SMILES | Nc1c2nc(-c3ccccc3)[nH]c(=O)c2nc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H13N5O2/c19-15-13-14(21-18(25)23(15)12-9-5-2-6-10-12)17(24)22-16(20-13)11-7-3-1-4-8-11/h1-10H,19H2,(H,20,22,24) |
| InChIKey | NMCWHNRQQFULQG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |