C14H13ClN4O2S — CID 135418279
7-chloro-1,1-dioxo-N-[(1S)-1-phenylethyl]-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine (PubChem CID 135418279) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 7-chloro-1,1-dioxo-N-[(1S)-1-phenylethyl]-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine.
| Compound Name | 7-chloro-1,1-dioxo-N-[(1S)-1-phenylethyl]-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine |
|---|---|
| PubChem CID | 135418279 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 7-chloro-1,1-dioxo-N-[(1S)-1-phenylethyl]-4H-pyrido[2,3-e][1,2,4]thiadiazin-3-imine |
| SMILES | C[C@H](/N=C1\Nc2ncc(Cl)cc2S(=O)(=O)N1)c1ccccc1 |
| InChI | InChI=1S/C14H13ClN4O2S/c1-9(10-5-3-2-4-6-10)17-14-18-13-12(22(20,21)19-14)7-11(15)8-16-13/h2-9H,1H3,(H2,16,17,18,19)/t9-/m0/s1 |
| InChIKey | NPJNUDQXBCUELD-VIFPVBQESA-N |
| XLogP | 2.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|