C18H18N2O4S — CID 135418606
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-methylbenzoate (PubChem CID 135418606) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-methylbenzoate.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-methylbenzoate |
|---|---|
| PubChem CID | 135418606 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O4S/c1-13-7-2-3-8-14(13)18(21)24-12-6-11-19-17-15-9-4-5-10-16(15)25(22,23)20-17/h2-5,7-10H,6,11-12H2,1H3,(H,19,20) |
| InChIKey | WQDDMUNHEHZRDL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|