About 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one (PubChem CID 135418698) has the molecular formula C14H12Cl2N2O2
and a molecular weight of 311.17 g/mol. Its IUPAC name is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one |
| PubChem CID | 135418698 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(C)n(/N=C/c2cc(Cl)cc(Cl)c2O)c(=O)c1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c1-8-3-9(2)18(13(19)4-8)17-7-10-5-11(15)6-12(16)14(10)20/h3-7,20H,1-2H3/b17-7+ |
| InChIKey | WNOSYZDWVAPALN-REZTVBANSA-N |
| XLogP | 3.36 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one?
The IUPAC name of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one (CID 135418698) is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one.
What is the SMILES notation for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one?
The canonical SMILES for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one is Cc1cc(C)n(/N=C/c2cc(Cl)cc(Cl)c2O)c(=O)c1.
What is the InChIKey of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one?
The InChIKey is WNOSYZDWVAPALN-REZTVBANSA-N. The full InChI is InChI=1S/C14H12Cl2N2O2/c1-8-3-9(2)18(13(19)4-8)17-7-10-5-11(15)6-12(16)14(10)20/h3-7,20H,1-2H3/b17-7+.
What are the key properties of 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one?
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one has a molecular weight of 311.17 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-4,6-dimethylpyridin-2-one is sourced from PubChem (CID 135418698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).