C21H23N3O4 — CID 135418715
4-(cyclohexanecarbonylamino)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]benzamide (PubChem CID 135418715) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135418715 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c25-18-11-8-16(19(26)12-18)13-22-24-21(28)15-6-9-17(10-7-15)23-20(27)14-4-2-1-3-5-14/h6-14,25-26H,1-5H2,(H,23,27)(H,24,28)/b22-13+ |
| InChIKey | IEVNMZBVZZWMDL-LPYMAVHISA-N |
| XLogP | 3.38 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|