C12H10Cl2N2O2 — CID 135419005
5-chloro-2-[(2-chlorophenoxy)methyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135419005) has the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 5-chloro-2-[(2-chlorophenoxy)methyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-[(2-chlorophenoxy)methyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135419005 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 5-chloro-2-[(2-chlorophenoxy)methyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(COc2ccccc2Cl)[nH]c(=O)c1Cl |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-7-11(14)12(17)16-10(15-7)6-18-9-5-3-2-4-8(9)13/h2-5H,6H2,1H3,(H,15,16,17) |
| InChIKey | YEOUMCKKQMNJRV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |