About N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine
N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine (PubChem CID 135419028) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine |
| PubChem CID | 135419028 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine |
| SMILES | ON=C(C(=NO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2/c17-15-13(11-7-3-1-4-8-11)14(16-18)12-9-5-2-6-10-12/h1-10,17-18H |
| InChIKey | JJZONEUCDUQVGR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine?
The IUPAC name of N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine (CID 135419028) is N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine.
What is the SMILES notation for N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine?
The canonical SMILES for N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine is ON=C(C(=NO)c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine?
The InChIKey is JJZONEUCDUQVGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c17-15-13(11-7-3-1-4-8-11)14(16-18)12-9-5-2-6-10-12/h1-10,17-18H.
What are the key properties of N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine?
N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine has a molecular weight of 240.26 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyimino-1,2-diphenylethylidene)hydroxylamine is sourced from PubChem (CID 135419028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).