C23H16N2O4 — CID 135419107
4-[2-[(Z)-2-(4-hydroxyphenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid (PubChem CID 135419107) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-[2-[(Z)-2-(4-hydroxyphenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid.
| Compound Name | 4-[2-[(Z)-2-(4-hydroxyphenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 135419107 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-[2-[(Z)-2-(4-hydroxyphenyl)ethenyl]-4-oxoquinazolin-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2c(/C=C\c3ccc(O)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H16N2O4/c26-18-12-5-15(6-13-18)7-14-21-24-20-4-2-1-3-19(20)22(27)25(21)17-10-8-16(9-11-17)23(28)29/h1-14,26H,(H,28,29)/b14-7- |
| InChIKey | MDOFFYPSLKIDGH-AUWJEWJLSA-N |
| XLogP | 3.96 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |