C19H17Cl2N3O3S — CID 135419159
2-(3,4-dichlorophenyl)imino-N-(4-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 135419159) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)imino-N-(4-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)imino-N-(4-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 135419159 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)imino-N-(4-ethoxyphenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CC(=O)N/C(=N/c3ccc(Cl)c(Cl)c3)S2)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c1-2-27-13-6-3-11(4-7-13)22-18(26)16-10-17(25)24-19(28-16)23-12-5-8-14(20)15(21)9-12/h3-9,16H,2,10H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | UMVPUIGYWJYKSU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|