C17H22N4O2 — CID 135419219
[3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]cyanamide (PubChem CID 135419219) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is [3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]cyanamide.
| Compound Name | [3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]cyanamide |
|---|---|
| PubChem CID | 135419219 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [3-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]cyanamide |
| SMILES | CC(C)(C)c1cc(-c2noc(NC#N)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H22N4O2/c1-16(2,3)11-7-10(8-12(13(11)22)17(4,5)6)14-20-15(19-9-18)23-21-14/h7-8,22H,1-6H3,(H,19,20,21) |
| InChIKey | BBOHPBJORQIKDS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|