About 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one
1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135419220) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135419220 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCSc1ccccc1-c1nc2c(c(C)nn2C)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N4OS/c1-4-9-22-12-8-6-5-7-11(12)14-17-15-13(16(21)18-14)10(2)19-20(15)3/h5-8H,4,9H2,1-3H3,(H,17,18,21) |
| InChIKey | XVEYMYLVVYMSTG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 135419220) is 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is CCCSc1ccccc1-c1nc2c(c(C)nn2C)c(=O)[nH]1.
What is the InChIKey of 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is XVEYMYLVVYMSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS/c1-4-9-22-12-8-6-5-7-11(12)14-17-15-13(16(21)18-14)10(2)19-20(15)3/h5-8H,4,9H2,1-3H3,(H,17,18,21).
What are the key properties of 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 314.41 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-(2-propylsulfanylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135419220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).