About [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate
[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate (PubChem CID 135420142) has the molecular formula C18H18N2O4S
and a molecular weight of 358.42 g/mol. Its IUPAC name is [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate |
| PubChem CID | 135420142 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate |
| SMILES | CC(C)(COC(=O)c1ccccc1)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H18N2O4S/c1-18(2,12-24-17(21)13-8-4-3-5-9-13)19-16-14-10-6-7-11-15(14)25(22,23)20-16/h3-11H,12H2,1-2H3,(H,19,20) |
| InChIKey | BWMNHEARKPLNNZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate?
The IUPAC name of [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate (CID 135420142) is [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate.
What is the SMILES notation for [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate?
The canonical SMILES for [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate is CC(C)(COC(=O)c1ccccc1)/N=C1\NS(=O)(=O)c2ccccc21.
What is the InChIKey of [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate?
The InChIKey is BWMNHEARKPLNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4S/c1-18(2,12-24-17(21)13-8-4-3-5-9-13)19-16-14-10-6-7-11-15(14)25(22,23)20-16/h3-11H,12H2,1-2H3,(H,19,20).
What are the key properties of [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate?
[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate has a molecular weight of 358.42 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropyl] benzoate is sourced from PubChem (CID 135420142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).