About 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one
4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one (PubChem CID 135421097) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one |
| PubChem CID | 135421097 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one |
| SMILES | C/C(=N\c1ccc(C)c(C)c1)C1=C(O)C(C)OC1=O |
| InChI | InChI=1S/C15H17NO3/c1-8-5-6-12(7-9(8)2)16-10(3)13-14(17)11(4)19-15(13)18/h5-7,11,17H,1-4H3/b16-10+ |
| InChIKey | SYMMKPQGRKDZAF-MHWRWJLKSA-N |
| XLogP | 3.15 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one?
The IUPAC name of 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one (CID 135421097) is 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one.
What is the SMILES notation for 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one?
The canonical SMILES for 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one is C/C(=N\c1ccc(C)c(C)c1)C1=C(O)C(C)OC1=O.
What is the InChIKey of 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one?
The InChIKey is SYMMKPQGRKDZAF-MHWRWJLKSA-N. The full InChI is InChI=1S/C15H17NO3/c1-8-5-6-12(7-9(8)2)16-10(3)13-14(17)11(4)19-15(13)18/h5-7,11,17H,1-4H3/b16-10+.
What are the key properties of 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one?
4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one has a molecular weight of 259.31 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[N-(3,4-dimethylphenyl)-C-methylcarbonimidoyl]-3-hydroxy-2-methyl-2H-furan-5-one is sourced from PubChem (CID 135421097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).