About methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate
methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 135421510) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate |
| PubChem CID | 135421510 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | C/N=C/C1=C(O)C(C(=O)OC)C(C)(C)CC1=O |
| InChI | InChI=1S/C12H17NO4/c1-12(2)5-8(14)7(6-13-3)10(15)9(12)11(16)17-4/h6,9,15H,5H2,1-4H3/b13-6+ |
| InChIKey | PUEKVSLQWPSPJY-AWNIVKPZSA-N |
| XLogP | 1.29 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate (CID 135421510) is methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate is C/N=C/C1=C(O)C(C(=O)OC)C(C)(C)CC1=O.
What is the InChIKey of methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate?
The InChIKey is PUEKVSLQWPSPJY-AWNIVKPZSA-N. The full InChI is InChI=1S/C12H17NO4/c1-12(2)5-8(14)7(6-13-3)10(15)9(12)11(16)17-4/h6,9,15H,5H2,1-4H3/b13-6+.
What are the key properties of methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate?
methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate has a molecular weight of 239.27 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-6,6-dimethyl-3-(methyliminomethyl)-4-oxocyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 135421510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).