C14H12N2O4 — CID 135421639
4-[(E)-[(E)-(3,4-dihydroxyphenyl)methylidenehydrazinylidene]methyl]benzene-1,2-diol (PubChem CID 135421639) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-[(E)-[(E)-(3,4-dihydroxyphenyl)methylidenehydrazinylidene]methyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-[(E)-(3,4-dihydroxyphenyl)methylidenehydrazinylidene]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135421639 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[(E)-[(E)-(3,4-dihydroxyphenyl)methylidenehydrazinylidene]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(/C=N/N=C/c2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C14H12N2O4/c17-11-3-1-9(5-13(11)19)7-15-16-8-10-2-4-12(18)14(20)6-10/h1-8,17-20H/b15-7+,16-8+ |
| InChIKey | KCTGBISRNNXGFG-BGPOSVGRSA-N |
| XLogP | 1.96 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|