About 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol
2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (PubChem CID 135421763) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| PubChem CID | 135421763 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| SMILES | COc1cc(/C=N/n2cnnc2)ccc1O |
| InChI | InChI=1S/C10H10N4O2/c1-16-10-4-8(2-3-9(10)15)5-13-14-6-11-12-7-14/h2-7,15H,1H3/b13-5+ |
| InChIKey | QRSNJXWHSDMEHC-WLRTZDKTSA-N |
| XLogP | 0.87 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The IUPAC name of 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (CID 135421763) is 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
What is the SMILES notation for 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The canonical SMILES for 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is COc1cc(/C=N/n2cnnc2)ccc1O.
What is the InChIKey of 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The InChIKey is QRSNJXWHSDMEHC-WLRTZDKTSA-N. The full InChI is InChI=1S/C10H10N4O2/c1-16-10-4-8(2-3-9(10)15)5-13-14-6-11-12-7-14/h2-7,15H,1H3/b13-5+.
What are the key properties of 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol has a molecular weight of 218.22 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is sourced from PubChem (CID 135421763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).