About sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid
sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 135421794) has the molecular formula C16H13N3NaO7S2+
and a molecular weight of 446.42 g/mol. Its IUPAC name is sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid.
Molecular Properties
| Compound Name | sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| PubChem CID | 135421794 |
| Molecular Formula | C16H13N3NaO7S2+ |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c12.[Na+] |
| InChI | InChI=1S/C16H13N3O7S2.Na/c17-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)19-18-10-4-2-1-3-5-10;/h1-8,20H,17H2,(H,21,22,23)(H,24,25,26);/q;+1/b19-18+; |
| InChIKey | KOJJEWBIWHKEIN-LTRPLHCISA-N |
| XLogP | 0.04 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid?
The IUPAC name of sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid (CID 135421794) is sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid.
What is the SMILES notation for sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid?
The canonical SMILES for sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid is Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c12.[Na+].
What is the InChIKey of sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid?
The InChIKey is KOJJEWBIWHKEIN-LTRPLHCISA-N. The full InChI is InChI=1S/C16H13N3O7S2.Na/c17-12-8-11(27(21,22)23)6-9-7-13(28(24,25)26)15(16(20)14(9)12)19-18-10-4-2-1-3-5-10;/h1-8,20H,17H2,(H,21,22,23)(H,24,25,26);/q;+1/b19-18+;.
What are the key properties of sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid?
sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid has a molecular weight of 446.42 g/mol, XLogP of 0.04, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonic acid is sourced from PubChem (CID 135421794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).