About 8-amino-1,7-dihydropurin-6-one
8-amino-1,7-dihydropurin-6-one (PubChem CID 135421879) has the molecular formula C5H5N5O
and a molecular weight of 151.13 g/mol. Its IUPAC name is 8-amino-1,7-dihydropurin-6-one.
Molecular Properties
| Compound Name | 8-amino-1,7-dihydropurin-6-one |
| PubChem CID | 135421879 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 8-amino-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C5H5N5O/c6-5-9-2-3(10-5)7-1-8-4(2)11/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | NVDXOOZGKFFGDJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-1,7-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-1,7-dihydropurin-6-one?
The IUPAC name of 8-amino-1,7-dihydropurin-6-one (CID 135421879) is 8-amino-1,7-dihydropurin-6-one.
What is the SMILES notation for 8-amino-1,7-dihydropurin-6-one?
The canonical SMILES for 8-amino-1,7-dihydropurin-6-one is Nc1nc2nc[nH]c(=O)c2[nH]1.
What is the InChIKey of 8-amino-1,7-dihydropurin-6-one?
The InChIKey is NVDXOOZGKFFGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O/c6-5-9-2-3(10-5)7-1-8-4(2)11/h1H,(H4,6,7,8,9,10,11).
What are the key properties of 8-amino-1,7-dihydropurin-6-one?
8-amino-1,7-dihydropurin-6-one has a molecular weight of 151.13 g/mol, XLogP of -0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-1,7-dihydropurin-6-one is sourced from PubChem (CID 135421879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).